C10H16FNO5S2 — CID 168674696
(2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 168674696) has the molecular formula C10H16FNO5S2 and a molecular weight of 313.37 g/mol. Its IUPAC name is (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 168674696 |
| Molecular Formula | C10H16FNO5S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (2R)-2-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)[C@@H](C(=O)O)N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H16FNO5S2/c1-10(2,18)8(9(14)15)12-4-6(3-7(12)13)5-19(11,16)17/h6,8,18H,3-5H2,1-2H3,(H,14,15)/t6?,8-/m1/s1 |
| InChIKey | MCVGEUCLORUSRE-QFSRMBNQSA-N |
| XLogP | 0.30 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|