C10H18N2O3S — CID 168658757
(2S)-2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 168658757) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is (2S)-2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | (2S)-2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 168658757 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (2S)-2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)[C@H](C(=O)O)N1CC(CN)CC1=O |
| InChI | InChI=1S/C10H18N2O3S/c1-10(2,16)8(9(14)15)12-5-6(4-11)3-7(12)13/h6,8,16H,3-5,11H2,1-2H3,(H,14,15)/t6?,8-/m0/s1 |
| InChIKey | YZBYNSHGNZXHJZ-XDKWHASVSA-N |
| XLogP | -0.04 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|