C9H14ClNO3S — CID 168686833
(2R)-2-(4-chloro-2-oxopyrrolidin-1-yl)-3-methyl-3-sulfanylbutanoic acid (PubChem CID 168686833) has the molecular formula C9H14ClNO3S and a molecular weight of 251.73 g/mol. Its IUPAC name is (2R)-2-(4-chloro-2-oxopyrrolidin-1-yl)-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | (2R)-2-(4-chloro-2-oxopyrrolidin-1-yl)-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 168686833 |
| Molecular Formula | C9H14ClNO3S |
| Molecular Weight | 251.73 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | (2R)-2-(4-chloro-2-oxopyrrolidin-1-yl)-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)[C@@H](C(=O)O)N1CC(Cl)CC1=O |
| InChI | InChI=1S/C9H14ClNO3S/c1-9(2,15)7(8(13)14)11-4-5(10)3-6(11)12/h5,7,15H,3-4H2,1-2H3,(H,13,14)/t5?,7-/m1/s1 |
| InChIKey | HFRQNDJSUNHBOU-NQPNHJOESA-N |
| XLogP | 0.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.73 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|