C8H12ClNO3 — CID 168686963
(2S)-2-(4-chloro-2-oxopyrrolidin-1-yl)butanoic acid (PubChem CID 168686963) has the molecular formula C8H12ClNO3 and a molecular weight of 205.64 g/mol. Its IUPAC name is (2S)-2-(4-chloro-2-oxopyrrolidin-1-yl)butanoic acid.
| Compound Name | (2S)-2-(4-chloro-2-oxopyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 168686963 |
| Molecular Formula | C8H12ClNO3 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (2S)-2-(4-chloro-2-oxopyrrolidin-1-yl)butanoic acid |
| SMILES | CC[C@@H](C(=O)O)N1CC(Cl)CC1=O |
| InChI | InChI=1S/C8H12ClNO3/c1-2-6(8(12)13)10-4-5(9)3-7(10)11/h5-6H,2-4H2,1H3,(H,12,13)/t5?,6-/m0/s1 |
| InChIKey | ZQTUPZMXAQTTIT-GDVGLLTNSA-N |
| XLogP | 0.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|