C8H14N2O6S — CID 168658950
2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-sulfopropanoic acid (PubChem CID 168658950) has the molecular formula C8H14N2O6S and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-sulfopropanoic acid.
| Compound Name | 2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 168658950 |
| Molecular Formula | C8H14N2O6S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-3-sulfopropanoic acid |
| SMILES | NCC1CC(=O)N(C(CS(=O)(=O)O)C(=O)O)C1 |
| InChI | InChI=1S/C8H14N2O6S/c9-2-5-1-7(11)10(3-5)6(8(12)13)4-17(14,15)16/h5-6H,1-4,9H2,(H,12,13)(H,14,15,16) |
| InChIKey | MZXYGZBDOPDSAL-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|