C7H12N2O3S — CID 168698989
(2R)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-sulfanylpropanoic acid (PubChem CID 168698989) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is (2R)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 168698989 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (2R)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-sulfanylpropanoic acid |
| SMILES | NC1CC(=O)N([C@@H](CS)C(=O)O)C1 |
| InChI | InChI=1S/C7H12N2O3S/c8-4-1-6(10)9(2-4)5(3-13)7(11)12/h4-5,13H,1-3,8H2,(H,11,12)/t4?,5-/m0/s1 |
| InChIKey | RKJIYQSNPDLVRI-AKGZTFGVSA-N |
| XLogP | -1.07 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|