C8H14N2O4 — CID 168698683
(2R,3S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-hydroxybutanoic acid (PubChem CID 168698683) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is (2R,3S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-hydroxybutanoic acid.
| Compound Name | (2R,3S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 168698683 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2R,3S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-hydroxybutanoic acid |
| SMILES | C[C@H](O)[C@H](C(=O)O)N1CC(N)CC1=O |
| InChI | InChI=1S/C8H14N2O4/c1-4(11)7(8(13)14)10-3-5(9)2-6(10)12/h4-5,7,11H,2-3,9H2,1H3,(H,13,14)/t4-,5?,7+/m0/s1 |
| InChIKey | YUZYPSWLMVUBNN-RMIHLSNLSA-N |
| XLogP | -1.62 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |