C13H15ClN2O3 — CID 168698995
(2S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-(4-chlorophenyl)propanoic acid (PubChem CID 168698995) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is (2S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-(4-chlorophenyl)propanoic acid.
| Compound Name | (2S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-(4-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 168698995 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2S)-2-(4-amino-2-oxopyrrolidin-1-yl)-3-(4-chlorophenyl)propanoic acid |
| SMILES | NC1CC(=O)N([C@@H](Cc2ccc(Cl)cc2)C(=O)O)C1 |
| InChI | InChI=1S/C13H15ClN2O3/c14-9-3-1-8(2-4-9)5-11(13(18)19)16-7-10(15)6-12(16)17/h1-4,10-11H,5-7,15H2,(H,18,19)/t10?,11-/m0/s1 |
| InChIKey | YTEGXUARCJJNQI-DTIOYNMSSA-N |
| XLogP | 0.90 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |