C15H14ClNO3 — CID 168500176
(2S)-3-(4-chlorophenyl)-2-(4-ethynyl-2-oxopyrrolidin-1-yl)propanoic acid (PubChem CID 168500176) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenyl)-2-(4-ethynyl-2-oxopyrrolidin-1-yl)propanoic acid.
| Compound Name | (2S)-3-(4-chlorophenyl)-2-(4-ethynyl-2-oxopyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 168500176 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2S)-3-(4-chlorophenyl)-2-(4-ethynyl-2-oxopyrrolidin-1-yl)propanoic acid |
| SMILES | C#CC1CC(=O)N([C@@H](Cc2ccc(Cl)cc2)C(=O)O)C1 |
| InChI | InChI=1S/C15H14ClNO3/c1-2-10-8-14(18)17(9-10)13(15(19)20)7-11-3-5-12(16)6-4-11/h1,3-6,10,13H,7-9H2,(H,19,20)/t10?,13-/m0/s1 |
| InChIKey | UYADKTYEVLMIEY-HQVZTVAUSA-N |
| XLogP | 1.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|