C11H19FN2O4S — CID 168675045
[1-[2-(tert-butylamino)-2-oxoethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675045) has the molecular formula C11H19FN2O4S and a molecular weight of 294.35 g/mol. Its IUPAC name is [1-[2-(tert-butylamino)-2-oxoethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[2-(tert-butylamino)-2-oxoethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675045 |
| Molecular Formula | C11H19FN2O4S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [1-[2-(tert-butylamino)-2-oxoethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC(C)(C)NC(=O)CN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H19FN2O4S/c1-11(2,3)13-9(15)6-14-5-8(4-10(14)16)7-19(12,17)18/h8H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | NUENINPRSNGNTJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |