C14H23ClN2O3 — CID 168686819
tert-butyl (3R)-3-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 168686819) has the molecular formula C14H23ClN2O3 and a molecular weight of 302.80 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168686819 |
| Molecular Formula | C14H23ClN2O3 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | tert-butyl (3R)-3-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](CN2CC(Cl)CC2=O)C1 |
| InChI | InChI=1S/C14H23ClN2O3/c1-14(2,3)20-13(19)16-5-4-10(7-16)8-17-9-11(15)6-12(17)18/h10-11H,4-9H2,1-3H3/t10-,11?/m0/s1 |
| InChIKey | MAMFBHIIEZVQTN-VUWPPUDQSA-N |
| XLogP | 2.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|