C15H25ClN2O4 — CID 168687195
tert-butyl 4-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 168687195) has the molecular formula C15H25ClN2O4 and a molecular weight of 332.83 g/mol. Its IUPAC name is tert-butyl 4-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 168687195 |
| Molecular Formula | C15H25ClN2O4 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | tert-butyl 4-[(4-chloro-2-oxopyrrolidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CN2CC(Cl)CC2=O)CC1 |
| InChI | InChI=1S/C15H25ClN2O4/c1-14(2,3)22-13(20)17-6-4-15(21,5-7-17)10-18-9-11(16)8-12(18)19/h11,21H,4-10H2,1-3H3 |
| InChIKey | FMYQHPRZTLQCIV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|