C15H28N2O3S — CID 145290232
tert-butyl 4-hydroxy-4-(thiomorpholin-4-ylmethyl)piperidine-1-carboxylate (PubChem CID 145290232) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-(thiomorpholin-4-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-(thiomorpholin-4-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145290232 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl 4-hydroxy-4-(thiomorpholin-4-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CN2CCSCC2)CC1 |
| InChI | InChI=1S/C15H28N2O3S/c1-14(2,3)20-13(18)17-6-4-15(19,5-7-17)12-16-8-10-21-11-9-16/h19H,4-12H2,1-3H3 |
| InChIKey | KLCLLNBRZFKSOQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |