C15H27FN2O3 — CID 121290195
tert-butyl 4-fluoro-4-(morpholin-4-ylmethyl)piperidine-1-carboxylate (PubChem CID 121290195) has the molecular formula C15H27FN2O3 and a molecular weight of 302.39 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-(morpholin-4-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-(morpholin-4-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121290195 |
| Molecular Formula | C15H27FN2O3 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl 4-fluoro-4-(morpholin-4-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C15H27FN2O3/c1-14(2,3)21-13(19)18-6-4-15(16,5-7-18)12-17-8-10-20-11-9-17/h4-12H2,1-3H3 |
| InChIKey | FHXYZJBGEZRXPX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |