C12H22FNO5S — CID 22248402
tert-butyl 4-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate (PubChem CID 22248402) has the molecular formula C12H22FNO5S and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22248402 |
| Molecular Formula | C12H22FNO5S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | tert-butyl 4-fluoro-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(COS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H22FNO5S/c1-11(2,3)19-10(15)14-7-5-12(13,6-8-14)9-18-20(4,16)17/h5-9H2,1-4H3 |
| InChIKey | QPQFKBRWMJIKMK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|