C20H41NO6S — CID 144606682
tert-butyl 3-(methylsulfonyloxymethyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate;ethane (PubChem CID 144606682) has the molecular formula C20H41NO6S and a molecular weight of 423.62 g/mol. Its IUPAC name is tert-butyl 3-(methylsulfonyloxymethyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate;ethane.
| Compound Name | tert-butyl 3-(methylsulfonyloxymethyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate;ethane |
|---|---|
| PubChem CID | 144606682 |
| Molecular Formula | C20H41NO6S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | tert-butyl 3-(methylsulfonyloxymethyl)-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)N1CCC2(CCC(COS(C)(=O)=O)CO2)CC1 |
| InChI | InChI=1S/C16H29NO6S.2C2H6/c1-15(2,3)23-14(18)17-9-7-16(8-10-17)6-5-13(11-21-16)12-22-24(4,19)20;2*1-2/h13H,5-12H2,1-4H3;2*1-2H3 |
| InChIKey | XDZDFGUOVXDQCK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|