C13H25NO5S — CID 22248052
tert-butyl 4-methyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate (PubChem CID 22248052) has the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. Its IUPAC name is tert-butyl 4-methyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22248052 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | tert-butyl 4-methyl-4-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC1(COS(C)(=O)=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25NO5S/c1-12(2,3)19-11(15)14-8-6-13(4,7-9-14)10-18-20(5,16)17/h6-10H2,1-5H3 |
| InChIKey | GPLDUALYAYSMEE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|