C13H26N2O2 — CID 131142821
tert-butyl 4-methyl-4-(methylaminomethyl)piperidine-1-carboxylate (PubChem CID 131142821) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is tert-butyl 4-methyl-4-(methylaminomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-4-(methylaminomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131142821 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | tert-butyl 4-methyl-4-(methylaminomethyl)piperidine-1-carboxylate |
| SMILES | CNCC1(C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-12(2,3)17-11(16)15-8-6-13(4,7-9-15)10-14-5/h14H,6-10H2,1-5H3 |
| InChIKey | YCWQDNWLFNJNDZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |