C16H32N2O4S — CID 104537826
tert-butyl 4-methyl-4-[(1-methylsulfonylpropan-2-ylamino)methyl]piperidine-1-carboxylate (PubChem CID 104537826) has the molecular formula C16H32N2O4S and a molecular weight of 348.51 g/mol. Its IUPAC name is tert-butyl 4-methyl-4-[(1-methylsulfonylpropan-2-ylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-methyl-4-[(1-methylsulfonylpropan-2-ylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104537826 |
| Molecular Formula | C16H32N2O4S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | tert-butyl 4-methyl-4-[(1-methylsulfonylpropan-2-ylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(CS(C)(=O)=O)NCC1(C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N2O4S/c1-13(11-23(6,20)21)17-12-16(5)7-9-18(10-8-16)14(19)22-15(2,3)4/h13,17H,7-12H2,1-6H3 |
| InChIKey | FNCRBPYCULJGJR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |