C17H33N3O2 — CID 107254596
tert-butyl 4-[[(3-aminocyclopentyl)amino]methyl]-4-methylpiperidine-1-carboxylate (PubChem CID 107254596) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl 4-[[(3-aminocyclopentyl)amino]methyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(3-aminocyclopentyl)amino]methyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 107254596 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | tert-butyl 4-[[(3-aminocyclopentyl)amino]methyl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC1(CNC2CCC(N)C2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33N3O2/c1-16(2,3)22-15(21)20-9-7-17(4,8-10-20)12-19-14-6-5-13(18)11-14/h13-14,19H,5-12,18H2,1-4H3 |
| InChIKey | BOKKNPGXKHFOFF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |