C18H30N2O3 — CID 86788331
tert-butyl 4-[(cyclopent-3-ene-1-carbonylamino)methyl]-4-methylpiperidine-1-carboxylate (PubChem CID 86788331) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 4-[(cyclopent-3-ene-1-carbonylamino)methyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(cyclopent-3-ene-1-carbonylamino)methyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86788331 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl 4-[(cyclopent-3-ene-1-carbonylamino)methyl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC1(CNC(=O)C2CC=CC2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30N2O3/c1-17(2,3)23-16(22)20-11-9-18(4,10-12-20)13-19-15(21)14-7-5-6-8-14/h5-6,14H,7-13H2,1-4H3,(H,19,21) |
| InChIKey | BCZYLEXLNADUSC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|