C17H33NO8S2 — CID 86645839
tert-butyl 4,4-bis(2-methylsulfonyloxyethyl)azepane-1-carboxylate (PubChem CID 86645839) has the molecular formula C17H33NO8S2 and a molecular weight of 443.58 g/mol. Its IUPAC name is tert-butyl 4,4-bis(2-methylsulfonyloxyethyl)azepane-1-carboxylate.
| Compound Name | tert-butyl 4,4-bis(2-methylsulfonyloxyethyl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 86645839 |
| Molecular Formula | C17H33NO8S2 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | tert-butyl 4,4-bis(2-methylsulfonyloxyethyl)azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CCOS(C)(=O)=O)(CCOS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H33NO8S2/c1-16(2,3)26-15(19)18-11-6-7-17(8-12-18,9-13-24-27(4,20)21)10-14-25-28(5,22)23/h6-14H2,1-5H3 |
| InChIKey | FLEFYJOYQFGRSH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|