C15H25NO5S — CID 164521525
tert-butyl 2-ethynyl-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylate (PubChem CID 164521525) has the molecular formula C15H25NO5S and a molecular weight of 331.43 g/mol. Its IUPAC name is tert-butyl 2-ethynyl-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-ethynyl-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164521525 |
| Molecular Formula | C15H25NO5S |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | tert-butyl 2-ethynyl-2-(3-methylsulfonyloxypropyl)pyrrolidine-1-carboxylate |
| SMILES | C#CC1(CCCOS(C)(=O)=O)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO5S/c1-6-15(10-8-12-20-22(5,18)19)9-7-11-16(15)13(17)21-14(2,3)4/h1H,7-12H2,2-5H3 |
| InChIKey | FEMDCTIGUNYAKU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|