C15H24N2O2 — CID 172909035
tert-butyl 2-cyano-2-(cyclopropylmethyl)piperidine-1-carboxylate (PubChem CID 172909035) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-(cyclopropylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-cyano-2-(cyclopropylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172909035 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | tert-butyl 2-cyano-2-(cyclopropylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1(C#N)CC1CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-14(2,3)19-13(18)17-9-5-4-8-15(17,11-16)10-12-6-7-12/h12H,4-10H2,1-3H3 |
| InChIKey | CMQTWEINXJYPIS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |