C12H21NO6S — CID 91525373
2-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 91525373) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91525373 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCS(=O)(=O)C1(C(=O)O)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO6S/c1-5-20(17,18)12(9(14)15)7-6-8-13(12)10(16)19-11(2,3)4/h5-8H2,1-4H3,(H,14,15) |
| InChIKey | VMKVDKYACJMOBB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |