C10H16INO4 — CID 134421765
(2R)-2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 134421765) has the molecular formula C10H16INO4 and a molecular weight of 341.15 g/mol. Its IUPAC name is (2R)-2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134421765 |
| Molecular Formula | C10H16INO4 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | (2R)-2-iodo-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]1(I)C(=O)O |
| InChI | InChI=1S/C10H16INO4/c1-9(2,3)16-8(15)12-6-4-5-10(12,11)7(13)14/h4-6H2,1-3H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | LELRMJBJXCMBTM-JTQLQIEISA-N |
| XLogP | 2.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|