C18H27NO5S — CID 18464415
tert-butyl 3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carboxylate (PubChem CID 18464415) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is tert-butyl 3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18464415 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | tert-butyl 3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCOS(C)(=O)=O)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H27NO5S/c1-17(2,3)24-16(20)19-12-10-18(14-19,11-13-23-25(4,21)22)15-8-6-5-7-9-15/h5-9H,10-14H2,1-4H3 |
| InChIKey | KFQBEBMYIHESNE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|