C23H29NO9S2 — CID 18464771
2-[1-(3,5-dimethoxy-4-methylsulfonyloxybenzoyl)-3-phenylpyrrolidin-3-yl]ethyl methanesulfonate (PubChem CID 18464771) has the molecular formula C23H29NO9S2 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[1-(3,5-dimethoxy-4-methylsulfonyloxybenzoyl)-3-phenylpyrrolidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[1-(3,5-dimethoxy-4-methylsulfonyloxybenzoyl)-3-phenylpyrrolidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 18464771 |
| Molecular Formula | C23H29NO9S2 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 2-[1-(3,5-dimethoxy-4-methylsulfonyloxybenzoyl)-3-phenylpyrrolidin-3-yl]ethyl methanesulfonate |
| SMILES | COc1cc(C(=O)N2CCC(CCOS(C)(=O)=O)(c3ccccc3)C2)cc(OC)c1OS(C)(=O)=O |
| InChI | InChI=1S/C23H29NO9S2/c1-30-19-14-17(15-20(31-2)21(19)33-35(4,28)29)22(25)24-12-10-23(16-24,11-13-32-34(3,26)27)18-8-6-5-7-9-18/h5-9,14-15H,10-13,16H2,1-4H3 |
| InChIKey | BLWXHQXPEYFGLQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|