C24H29N5O7S — CID 15392024
2-[3-(3,4-dimethoxyphenyl)-1-[2-methoxy-5-(tetrazol-1-yl)benzoyl]pyrrolidin-3-yl]ethyl methanesulfonate (PubChem CID 15392024) has the molecular formula C24H29N5O7S and a molecular weight of 531.59 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)-1-[2-methoxy-5-(tetrazol-1-yl)benzoyl]pyrrolidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)-1-[2-methoxy-5-(tetrazol-1-yl)benzoyl]pyrrolidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 15392024 |
| Molecular Formula | C24H29N5O7S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)-1-[2-methoxy-5-(tetrazol-1-yl)benzoyl]pyrrolidin-3-yl]ethyl methanesulfonate |
| SMILES | COc1ccc(C2(CCOS(C)(=O)=O)CCN(C(=O)c3cc(-n4cnnn4)ccc3OC)C2)cc1OC |
| InChI | InChI=1S/C24H29N5O7S/c1-33-20-8-6-18(29-16-25-26-27-29)14-19(20)23(30)28-11-9-24(15-28,10-12-36-37(4,31)32)17-5-7-21(34-2)22(13-17)35-3/h5-8,13-14,16H,9-12,15H2,1-4H3 |
| InChIKey | VQFQLSCPQRNOLG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 134.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|