C23H27Cl2NO5S — CID 22866201
2-[(3S)-3-(3,4-dichlorophenyl)-1-(2-methoxybenzoyl)azepan-3-yl]ethyl methanesulfonate (PubChem CID 22866201) has the molecular formula C23H27Cl2NO5S and a molecular weight of 500.44 g/mol. Its IUPAC name is 2-[(3S)-3-(3,4-dichlorophenyl)-1-(2-methoxybenzoyl)azepan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-3-(3,4-dichlorophenyl)-1-(2-methoxybenzoyl)azepan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22866201 |
| Molecular Formula | C23H27Cl2NO5S |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 2-[(3S)-3-(3,4-dichlorophenyl)-1-(2-methoxybenzoyl)azepan-3-yl]ethyl methanesulfonate |
| SMILES | COc1ccccc1C(=O)N1CCCC[C@](CCOS(C)(=O)=O)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H27Cl2NO5S/c1-30-21-8-4-3-7-18(21)22(27)26-13-6-5-11-23(16-26,12-14-31-32(2,28)29)17-9-10-19(24)20(25)15-17/h3-4,7-10,15H,5-6,11-14,16H2,1-2H3/t23-/m1/s1 |
| InChIKey | AWXSWIFFJLVRHG-HSZRJFAPSA-N |
| XLogP | 4.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|