C25H33NO7S — CID 18464895
2-[3-(3,4-dimethylphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl methanesulfonate (PubChem CID 18464895) has the molecular formula C25H33NO7S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-[3-(3,4-dimethylphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[3-(3,4-dimethylphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 18464895 |
| Molecular Formula | C25H33NO7S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[3-(3,4-dimethylphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl methanesulfonate |
| SMILES | COc1cc(C(=O)N2CCC(CCOS(C)(=O)=O)(c3ccc(C)c(C)c3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C25H33NO7S/c1-17-7-8-20(13-18(17)2)25(10-12-33-34(6,28)29)9-11-26(16-25)24(27)19-14-21(30-3)23(32-5)22(15-19)31-4/h7-8,13-15H,9-12,16H2,1-6H3 |
| InChIKey | ZEPPJLUXJHOXIW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|