C25H31ClFNO4S — CID 22866215
2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate (PubChem CID 22866215) has the molecular formula C25H31ClFNO4S and a molecular weight of 496.04 g/mol. Its IUPAC name is 2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22866215 |
| Molecular Formula | C25H31ClFNO4S |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate |
| SMILES | Cc1ccc([C@@]2(CCOS(C)(=O)=O)CCCCN(C(=O)Cc3c(F)cccc3Cl)C2)cc1C |
| InChI | InChI=1S/C25H31ClFNO4S/c1-18-9-10-20(15-19(18)2)25(12-14-32-33(3,30)31)11-4-5-13-28(17-25)24(29)16-21-22(26)7-6-8-23(21)27/h6-10,15H,4-5,11-14,16-17H2,1-3H3/t25-/m1/s1 |
| InChIKey | OLKMVKPYDBFPQD-RUZDIDTESA-N |
| XLogP | 4.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|