C27H25Cl6F6NO4S — CID 22866196
2-[(3S)-3-[3,4-bis(trichloromethyl)phenyl]-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]azepan-3-yl]ethyl methanesulfonate (PubChem CID 22866196) has the molecular formula C27H25Cl6F6NO4S and a molecular weight of 786.27 g/mol. Its IUPAC name is 2-[(3S)-3-[3,4-bis(trichloromethyl)phenyl]-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]azepan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-3-[3,4-bis(trichloromethyl)phenyl]-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]azepan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22866196 |
| Molecular Formula | C27H25Cl6F6NO4S |
| Molecular Weight | 786.27 g/mol |
| Exact Mass | 782.95 |
| IUPAC Name | 2-[(3S)-3-[3,4-bis(trichloromethyl)phenyl]-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]azepan-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@]1(c2ccc(C(Cl)(Cl)Cl)c(C(Cl)(Cl)Cl)c2)CCCCN(C(=O)Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C27H25Cl6F6NO4S/c1-45(42,43)44-9-7-23(17-4-5-20(24(28,29)30)21(14-17)25(31,32)33)6-2-3-8-40(15-23)22(41)12-16-10-18(26(34,35)36)13-19(11-16)27(37,38)39/h4-5,10-11,13-14H,2-3,6-9,12,15H2,1H3/t23-/m1/s1 |
| InChIKey | KBQXHIROWCDYIM-HSZRJFAPSA-N |
| XLogP | 9.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.27 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|