C25H25F8NO4S — CID 22866210
2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-difluorophenyl)azepan-3-yl]ethyl methanesulfonate (PubChem CID 22866210) has the molecular formula C25H25F8NO4S and a molecular weight of 587.53 g/mol. Its IUPAC name is 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-difluorophenyl)azepan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-difluorophenyl)azepan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22866210 |
| Molecular Formula | C25H25F8NO4S |
| Molecular Weight | 587.53 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(3,4-difluorophenyl)azepan-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@]1(c2ccc(F)c(F)c2)CCCCN(C(=O)Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H25F8NO4S/c1-39(36,37)38-9-7-23(17-4-5-20(26)21(27)14-17)6-2-3-8-34(15-23)22(35)12-16-10-18(24(28,29)30)13-19(11-16)25(31,32)33/h4-5,10-11,13-14H,2-3,6-9,12,15H2,1H3/t23-/m1/s1 |
| InChIKey | WWVAZNZAHTULLA-HSZRJFAPSA-N |
| XLogP | 5.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|