C26H29F6NO4S — CID 22866220
2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(4-methylphenyl)azepan-3-yl]ethyl methanesulfonate (PubChem CID 22866220) has the molecular formula C26H29F6NO4S and a molecular weight of 565.58 g/mol. Its IUPAC name is 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(4-methylphenyl)azepan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(4-methylphenyl)azepan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22866220 |
| Molecular Formula | C26H29F6NO4S |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(4-methylphenyl)azepan-3-yl]ethyl methanesulfonate |
| SMILES | Cc1ccc([C@@]2(CCOS(C)(=O)=O)CCCCN(C(=O)Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2)cc1 |
| InChI | InChI=1S/C26H29F6NO4S/c1-18-5-7-20(8-6-18)24(10-12-37-38(2,35)36)9-3-4-11-33(17-24)23(34)15-19-13-21(25(27,28)29)16-22(14-19)26(30,31)32/h5-8,13-14,16H,3-4,9-12,15,17H2,1-2H3/t24-/m1/s1 |
| InChIKey | POHGHSYMXCYPLL-XMMPIXPASA-N |
| XLogP | 5.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|