C23H21Cl2F6NO4S — CID 54160351
2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3,4-dichlorophenyl)-6-oxopiperidin-3-yl]ethyl methanesulfonate (PubChem CID 54160351) has the molecular formula C23H21Cl2F6NO4S and a molecular weight of 592.39 g/mol. Its IUPAC name is 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3,4-dichlorophenyl)-6-oxopiperidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3,4-dichlorophenyl)-6-oxopiperidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 54160351 |
| Molecular Formula | C23H21Cl2F6NO4S |
| Molecular Weight | 592.39 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3,4-dichlorophenyl)-6-oxopiperidin-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1(c2ccc(Cl)c(Cl)c2)CCC(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C23H21Cl2F6NO4S/c1-37(34,35)36-7-6-21(15-2-3-18(24)19(25)11-15)5-4-20(33)32(13-21)12-14-8-16(22(26,27)28)10-17(9-14)23(29,30)31/h2-3,8-11H,4-7,12-13H2,1H3 |
| InChIKey | ONZABDFDSDMXML-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|