C36H37Cl2F6N2O+ — CID 22376640
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,4-dichlorophenyl)-6-(1-ethyl-4-phenyl-1-azoniabicyclo[2.2.2]octan-2-yl)azepan-2-one (PubChem CID 22376640) has the molecular formula C36H37Cl2F6N2O+ and a molecular weight of 698.60 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,4-dichlorophenyl)-6-(1-ethyl-4-phenyl-1-azoniabicyclo[2.2.2]octan-2-yl)azepan-2-one.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,4-dichlorophenyl)-6-(1-ethyl-4-phenyl-1-azoniabicyclo[2.2.2]octan-2-yl)azepan-2-one |
|---|---|
| PubChem CID | 22376640 |
| Molecular Formula | C36H37Cl2F6N2O+ |
| Molecular Weight | 698.60 g/mol |
| Exact Mass | 697.22 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(3,4-dichlorophenyl)-6-(1-ethyl-4-phenyl-1-azoniabicyclo[2.2.2]octan-2-yl)azepan-2-one |
| SMILES | CC[N+]12CCC(c3ccccc3)(CC1)CC2C1(c2ccc(Cl)c(Cl)c2)CCCC(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C36H37Cl2F6N2O/c1-2-46-15-13-33(14-16-46,25-7-4-3-5-8-25)21-31(46)34(26-10-11-29(37)30(38)20-26)12-6-9-32(47)45(23-34)22-24-17-27(35(39,40)41)19-28(18-24)36(42,43)44/h3-5,7-8,10-11,17-20,31H,2,6,9,12-16,21-23H2,1H3/q+1 |
| InChIKey | MCHFHHVWMGESNE-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.60 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|