About 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one
1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one (PubChem CID 19692506) has the molecular formula C25H29Cl2NO4
and a molecular weight of 478.42 g/mol. Its IUPAC name is 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one |
| PubChem CID | 19692506 |
| Molecular Formula | C25H29Cl2NO4 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one |
| SMILES | O=C1CCC(OCCOC2CCCCO2)(c2ccc(Cl)c(Cl)c2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C25H29Cl2NO4/c26-21-10-9-20(16-22(21)27)25(32-15-14-31-24-8-4-5-13-30-24)12-11-23(29)28(18-25)17-19-6-2-1-3-7-19/h1-3,6-7,9-10,16,24H,4-5,8,11-15,17-18H2 |
| InChIKey | HBWAOESYGZGSHZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one?
The IUPAC name of 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one (CID 19692506) is 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one.
What is the SMILES notation for 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one?
The canonical SMILES for 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one is O=C1CCC(OCCOC2CCCCO2)(c2ccc(Cl)c(Cl)c2)CN1Cc1ccccc1.
What is the InChIKey of 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one?
The InChIKey is HBWAOESYGZGSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29Cl2NO4/c26-21-10-9-20(16-22(21)27)25(32-15-14-31-24-8-4-5-13-30-24)12-11-23(29)28(18-25)17-19-6-2-1-3-7-19/h1-3,6-7,9-10,16,24H,4-5,8,11-15,17-18H2.
What are the key properties of 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one?
1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one has a molecular weight of 478.42 g/mol, XLogP of 5.57, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-(3,4-dichlorophenyl)-5-[2-(oxan-2-yloxy)ethoxy]piperidin-2-one is sourced from PubChem (CID 19692506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).