C21H21Cl3FNO4S — CID 22870249
2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethyl methanesulfonate (PubChem CID 22870249) has the molecular formula C21H21Cl3FNO4S and a molecular weight of 508.83 g/mol. Its IUPAC name is 2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22870249 |
| Molecular Formula | C21H21Cl3FNO4S |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 2-[(3S)-1-[2-(2-chloro-6-fluorophenyl)acetyl]-3-(3,4-dichlorophenyl)pyrrolidin-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@]1(c2ccc(Cl)c(Cl)c2)CCN(C(=O)Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C21H21Cl3FNO4S/c1-31(28,29)30-10-8-21(14-5-6-17(23)18(24)11-14)7-9-26(13-21)20(27)12-15-16(22)3-2-4-19(15)25/h2-6,11H,7-10,12-13H2,1H3/t21-/m1/s1 |
| InChIKey | YUDAASMABHMNCP-OAQYLSRUSA-N |
| XLogP | 4.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|