C25H21Cl3F9NO4S — CID 19970068
2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-[4-(trichloromethyl)-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethyl methanesulfonate (PubChem CID 19970068) has the molecular formula C25H21Cl3F9NO4S and a molecular weight of 708.85 g/mol. Its IUPAC name is 2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-[4-(trichloromethyl)-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-[4-(trichloromethyl)-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 19970068 |
| Molecular Formula | C25H21Cl3F9NO4S |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 707.01 |
| IUPAC Name | 2-[1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-[4-(trichloromethyl)-3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1(c2ccc(C(Cl)(Cl)Cl)c(C(F)(F)F)c2)CCN(C(=O)Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H21Cl3F9NO4S/c1-43(40,41)42-7-5-21(15-2-3-18(22(26,27)28)19(12-15)25(35,36)37)4-6-38(13-21)20(39)10-14-8-16(23(29,30)31)11-17(9-14)24(32,33)34/h2-3,8-9,11-12H,4-7,10,13H2,1H3 |
| InChIKey | AYQKFMBCOSIRRX-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|