C27H31F6NO4S — CID 22866193
2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(2,5-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate (PubChem CID 22866193) has the molecular formula C27H31F6NO4S and a molecular weight of 579.60 g/mol. Its IUPAC name is 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(2,5-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(2,5-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22866193 |
| Molecular Formula | C27H31F6NO4S |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 2-[(3S)-1-[2-[3,5-bis(trifluoromethyl)phenyl]acetyl]-3-(2,5-dimethylphenyl)azepan-3-yl]ethyl methanesulfonate |
| SMILES | Cc1ccc(C)c([C@@]2(CCOS(C)(=O)=O)CCCCN(C(=O)Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2)c1 |
| InChI | InChI=1S/C27H31F6NO4S/c1-18-6-7-19(2)23(12-18)25(9-11-38-39(3,36)37)8-4-5-10-34(17-25)24(35)15-20-13-21(26(28,29)30)16-22(14-20)27(31,32)33/h6-7,12-14,16H,4-5,8-11,15,17H2,1-3H3/t25-/m1/s1 |
| InChIKey | HLHVWJOQWGDETM-RUZDIDTESA-N |
| XLogP | 6.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|