C27H33N5O7S — CID 18465048
ethyl 4-[2-[3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carbonyl]-4-(tetrazol-1-yl)phenoxy]butanoate (PubChem CID 18465048) has the molecular formula C27H33N5O7S and a molecular weight of 571.66 g/mol. Its IUPAC name is ethyl 4-[2-[3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carbonyl]-4-(tetrazol-1-yl)phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carbonyl]-4-(tetrazol-1-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 18465048 |
| Molecular Formula | C27H33N5O7S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | ethyl 4-[2-[3-(2-methylsulfonyloxyethyl)-3-phenylpyrrolidine-1-carbonyl]-4-(tetrazol-1-yl)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(-n2cnnn2)cc1C(=O)N1CCC(CCOS(C)(=O)=O)(c2ccccc2)C1 |
| InChI | InChI=1S/C27H33N5O7S/c1-3-37-25(33)10-7-16-38-24-12-11-22(32-20-28-29-30-32)18-23(24)26(34)31-15-13-27(19-31,14-17-39-40(2,35)36)21-8-5-4-6-9-21/h4-6,8-9,11-12,18,20H,3,7,10,13-17,19H2,1-2H3 |
| InChIKey | DHKMFPVYPMUSOJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 142.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|