C36H45N5O4 — CID 54341706
[3-[2-[4-(1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylamino)piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 54341706) has the molecular formula C36H45N5O4 and a molecular weight of 611.79 g/mol. Its IUPAC name is [3-[2-[4-(1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylamino)piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [3-[2-[4-(1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylamino)piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 54341706 |
| Molecular Formula | C36H45N5O4 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | [3-[2-[4-(1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylamino)piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCC(CCN3CCC(NC4N5CCN4c4ccccc45)CC3)(c3ccccc3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C36H45N5O4/c1-43-31-23-26(24-32(44-2)33(31)45-3)34(42)39-20-16-36(25-39,27-9-5-4-6-10-27)15-19-38-17-13-28(14-18-38)37-35-40-21-22-41(35)30-12-8-7-11-29(30)40/h4-12,23-24,28,35,37H,13-22,25H2,1-3H3 |
| InChIKey | TZKNCCPXXSXOMW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |