C25H34N2O3 — CID 143255426
tert-butyl 4-(2-amino-2-oxoethyl)-4-phenylpiperidine-1-carboxylate;toluene (PubChem CID 143255426) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is tert-butyl 4-(2-amino-2-oxoethyl)-4-phenylpiperidine-1-carboxylate;toluene.
| Compound Name | tert-butyl 4-(2-amino-2-oxoethyl)-4-phenylpiperidine-1-carboxylate;toluene |
|---|---|
| PubChem CID | 143255426 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | tert-butyl 4-(2-amino-2-oxoethyl)-4-phenylpiperidine-1-carboxylate;toluene |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(N)=O)(c2ccccc2)CC1.Cc1ccccc1 |
| InChI | InChI=1S/C18H26N2O3.C7H8/c1-17(2,3)23-16(22)20-11-9-18(10-12-20,13-15(19)21)14-7-5-4-6-8-14;1-7-5-3-2-4-6-7/h4-8H,9-13H2,1-3H3,(H2,19,21);2-6H,1H3 |
| InChIKey | YTIZRTRIRMZAFB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |