C21H31N3O5S — CID 168716791
tert-butyl 4-[(2-oxo-4-sulfamoylpyrrolidin-1-yl)methyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 168716791) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is tert-butyl 4-[(2-oxo-4-sulfamoylpyrrolidin-1-yl)methyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-oxo-4-sulfamoylpyrrolidin-1-yl)methyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 168716791 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | tert-butyl 4-[(2-oxo-4-sulfamoylpyrrolidin-1-yl)methyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CC(S(N)(=O)=O)CC2=O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N3O5S/c1-20(2,3)29-19(26)23-11-9-21(10-12-23,16-7-5-4-6-8-16)15-24-14-17(13-18(24)25)30(22,27)28/h4-8,17H,9-15H2,1-3H3,(H2,22,27,28) |
| InChIKey | HCVSMBGDZSVMIU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |