C15H29N3O4 — CID 126847247
tert-butyl 4-hydroxy-4-[(morpholin-4-ylamino)methyl]piperidine-1-carboxylate (PubChem CID 126847247) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[(morpholin-4-ylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[(morpholin-4-ylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126847247 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[(morpholin-4-ylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CNN2CCOCC2)CC1 |
| InChI | InChI=1S/C15H29N3O4/c1-14(2,3)22-13(19)17-6-4-15(20,5-7-17)12-16-18-8-10-21-11-9-18/h16,20H,4-12H2,1-3H3 |
| InChIKey | IGJRYJTVBLEJAI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |