C15H30N2O3 — CID 54250356
tert-butyl 4-hydroxy-4-[(2-methylpropylamino)methyl]piperidine-1-carboxylate (PubChem CID 54250356) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[(2-methylpropylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[(2-methylpropylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54250356 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[(2-methylpropylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)CNCC1(O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O3/c1-12(2)10-16-11-15(19)6-8-17(9-7-15)13(18)20-14(3,4)5/h12,16,19H,6-11H2,1-5H3 |
| InChIKey | QWHRNJRBYWNIRJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |