C18H23F3N4O3 — CID 166082675
tert-butyl (10R)-8-ethyl-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate (PubChem CID 166082675) has the molecular formula C18H23F3N4O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is tert-butyl (10R)-8-ethyl-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | tert-butyl (10R)-8-ethyl-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 166082675 |
| Molecular Formula | C18H23F3N4O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | tert-butyl (10R)-8-ethyl-9-oxo-5-(trifluoromethyl)-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCN1C(=O)[C@H]2CN(C(=O)OC(C)(C)C)CCN2c2ncc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H23F3N4O3/c1-5-24-12-8-11(18(19,20)21)9-22-14(12)25-7-6-23(10-13(25)15(24)26)16(27)28-17(2,3)4/h8-9,13H,5-7,10H2,1-4H3/t13-/m1/s1 |
| InChIKey | QLZDZQPCRUCVAL-CYBMUJFWSA-N |
| XLogP | 2.89 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |