C17H21F3N4O3 — CID 164854793
tert-butyl 9-oxo-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate (PubChem CID 164854793) has the molecular formula C17H21F3N4O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is tert-butyl 9-oxo-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate.
| Compound Name | tert-butyl 9-oxo-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 164854793 |
| Molecular Formula | C17H21F3N4O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | tert-butyl 9-oxo-5-(trifluoromethyl)-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3ncc(C(F)(F)F)cc3NC(=O)CC2C1 |
| InChI | InChI=1S/C17H21F3N4O3/c1-16(2,3)27-15(26)23-4-5-24-11(9-23)7-13(25)22-12-6-10(17(18,19)20)8-21-14(12)24/h6,8,11H,4-5,7,9H2,1-3H3,(H,22,25) |
| InChIKey | XQBZBTJKLNPWHE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |