C17H23N3O3 — CID 67247695
tert-butyl (4aS)-6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate (PubChem CID 67247695) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl (4aS)-6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate.
| Compound Name | tert-butyl (4aS)-6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 67247695 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl (4aS)-6-oxo-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,5]benzodiazepine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3ccccc3NC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C17H23N3O3/c1-17(2,3)23-16(22)19-8-9-20-12(11-19)10-15(21)18-13-6-4-5-7-14(13)20/h4-7,12H,8-11H2,1-3H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | JORDJJYSVWGKCR-LBPRGKRZSA-N |
| XLogP | 2.45 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |